C15H16Cl3N3O2S — CID 135775069
2-[(5R)-2-(2-methylpropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,5-trichlorophenyl)acetamide (PubChem CID 135775069) has the molecular formula C15H16Cl3N3O2S and a molecular weight of 408.74 g/mol. Its IUPAC name is 2-[(5R)-2-(2-methylpropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,5-trichlorophenyl)acetamide.
| Compound Name | 2-[(5R)-2-(2-methylpropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,5-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 135775069 |
| Molecular Formula | C15H16Cl3N3O2S |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 407.00 |
| IUPAC Name | 2-[(5R)-2-(2-methylpropylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-(2,4,5-trichlorophenyl)acetamide |
| SMILES | CC(C)C/N=C1\NC(=O)[C@@H](CC(=O)Nc2cc(Cl)c(Cl)cc2Cl)S1 |
| InChI | InChI=1S/C15H16Cl3N3O2S/c1-7(2)6-19-15-21-14(23)12(24-15)5-13(22)20-11-4-9(17)8(16)3-10(11)18/h3-4,7,12H,5-6H2,1-2H3,(H,20,22)(H,19,21,23)/t12-/m1/s1 |
| InChIKey | KIPQZYUFVTUWJR-GFCCVEGCSA-N |
| XLogP | 4.22 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|