C15H16F3N3O3S — CID 135691489
2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 135691489) has the molecular formula C15H16F3N3O3S and a molecular weight of 375.37 g/mol. Its IUPAC name is 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135691489 |
| Molecular Formula | C15H16F3N3O3S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 2-[(5S)-2-(2-methoxyethylimino)-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCC/N=C1\NC(=O)[C@H](CC(=O)Nc2ccccc2C(F)(F)F)S1 |
| InChI | InChI=1S/C15H16F3N3O3S/c1-24-7-6-19-14-21-13(23)11(25-14)8-12(22)20-10-5-3-2-4-9(10)15(16,17)18/h2-5,11H,6-8H2,1H3,(H,20,22)(H,19,21,23)/t11-/m0/s1 |
| InChIKey | BCTFAGYZQAEMDO-NSHDSACASA-N |
| XLogP | 2.27 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|