C20H17F3N4O3S — CID 135426326
2-[(2Z)-2-[(E)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 135426326) has the molecular formula C20H17F3N4O3S and a molecular weight of 450.44 g/mol. Its IUPAC name is 2-[(2Z)-2-[(E)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(2Z)-2-[(E)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135426326 |
| Molecular Formula | C20H17F3N4O3S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | 2-[(2Z)-2-[(E)-(2-methoxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccccc1/C=N/N=C1/NC(=O)C(CC(=O)Nc2ccccc2C(F)(F)F)S1 |
| InChI | InChI=1S/C20H17F3N4O3S/c1-30-15-9-5-2-6-12(15)11-24-27-19-26-18(29)16(31-19)10-17(28)25-14-8-4-3-7-13(14)20(21,22)23/h2-9,11,16H,10H2,1H3,(H,25,28)(H,26,27,29)/b24-11+ |
| InChIKey | JRQLGNGZOBQRNL-BHGWPJFGSA-N |
| XLogP | 3.66 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|