C20H18F3N3O2S — CID 135834005
2-[(5R)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 135834005) has the molecular formula C20H18F3N3O2S and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-[(5R)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(5R)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135834005 |
| Molecular Formula | C20H18F3N3O2S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 2-[(5R)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(/N=C2\NC(=O)[C@@H](CC(=O)Nc3ccccc3C(F)(F)F)S2)cc1C |
| InChI | InChI=1S/C20H18F3N3O2S/c1-11-7-8-13(9-12(11)2)24-19-26-18(28)16(29-19)10-17(27)25-15-6-4-3-5-14(15)20(21,22)23/h3-9,16H,10H2,1-2H3,(H,25,27)(H,24,26,28)/t16-/m1/s1 |
| InChIKey | KYASERCCSIUFGP-MRXNPFEDSA-N |
| XLogP | 4.57 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|