C19H12ClF3N4O2S — CID 171982527
2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-cyanophenyl)acetamide (PubChem CID 171982527) has the molecular formula C19H12ClF3N4O2S and a molecular weight of 452.85 g/mol. Its IUPAC name is 2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-cyanophenyl)acetamide.
| Compound Name | 2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-cyanophenyl)acetamide |
|---|---|
| PubChem CID | 171982527 |
| Molecular Formula | C19H12ClF3N4O2S |
| Molecular Weight | 452.85 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | 2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]-N-(2-cyanophenyl)acetamide |
| SMILES | N#Cc1ccccc1NC(=O)CC1S/C(=N\c2ccc(Cl)c(C(F)(F)F)c2)NC1=O |
| InChI | InChI=1S/C19H12ClF3N4O2S/c20-13-6-5-11(7-12(13)19(21,22)23)25-18-27-17(29)15(30-18)8-16(28)26-14-4-2-1-3-10(14)9-24/h1-7,15H,8H2,(H,26,28)(H,25,27,29) |
| InChIKey | UZWPZURCOLAXJU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 94.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.85 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|