C17H19N5O2S — CID 137195508
N-(2-cyanophenyl)-2-[(5R)-2-(3-methylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 137195508) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-(2-cyanophenyl)-2-[(5R)-2-(3-methylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2-cyanophenyl)-2-[(5R)-2-(3-methylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 137195508 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-(2-cyanophenyl)-2-[(5R)-2-(3-methylbutan-2-ylidenehydrazinylidene)-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC(=NN=C1NC(=O)[C@@H](CC(=O)Nc2ccccc2C#N)S1)C(C)C |
| InChI | InChI=1S/C17H19N5O2S/c1-10(2)11(3)21-22-17-20-16(24)14(25-17)8-15(23)19-13-7-5-4-6-12(13)9-18/h4-7,10,14H,8H2,1-3H3,(H,19,23)(H,20,22,24)/t14-/m1/s1 |
| InChIKey | FTEVWDWNUBCIPJ-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 106.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|