C19H18ClN3O2S — CID 135691582
N-(3-chloro-2-methylphenyl)-2-[(5R)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135691582) has the molecular formula C19H18ClN3O2S and a molecular weight of 387.89 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[(5R)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[(5R)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135691582 |
| Molecular Formula | C19H18ClN3O2S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[(5R)-2-(3-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1cccc(/N=C2/NC(=O)[C@@H](CC(=O)Nc3cccc(Cl)c3C)S2)c1 |
| InChI | InChI=1S/C19H18ClN3O2S/c1-11-5-3-6-13(9-11)21-19-23-18(25)16(26-19)10-17(24)22-15-8-4-7-14(20)12(15)2/h3-9,16H,10H2,1-2H3,(H,22,24)(H,21,23,25)/t16-/m1/s1 |
| InChIKey | NFJPAMLVIIWMKC-MRXNPFEDSA-N |
| XLogP | 4.20 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|