C19H15Cl3N4O2S — CID 135913114
N-(3-chloro-2-methylphenyl)-2-[(2Z,5R)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135913114) has the molecular formula C19H15Cl3N4O2S and a molecular weight of 469.78 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[(2Z,5R)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[(2Z,5R)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135913114 |
| Molecular Formula | C19H15Cl3N4O2S |
| Molecular Weight | 469.78 g/mol |
| Exact Mass | 468.00 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[(2Z,5R)-2-[(Z)-(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)C[C@H]1S/C(=N\N=C/c2ccc(Cl)cc2Cl)NC1=O |
| InChI | InChI=1S/C19H15Cl3N4O2S/c1-10-13(21)3-2-4-15(10)24-17(27)8-16-18(28)25-19(29-16)26-23-9-11-5-6-12(20)7-14(11)22/h2-7,9,16H,8H2,1H3,(H,24,27)(H,25,26,28)/b23-9-/t16-/m1/s1 |
| InChIKey | YPHAKNIGOVLDOK-ASXOHSQJSA-N |
| XLogP | 4.91 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.78 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|