C18H14Cl2N4O3S — CID 135665531
N-(2,3-dichlorophenyl)-2-[(2E)-2-[(3-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135665531) has the molecular formula C18H14Cl2N4O3S and a molecular weight of 437.31 g/mol. Its IUPAC name is N-(2,3-dichlorophenyl)-2-[(2E)-2-[(3-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(2,3-dichlorophenyl)-2-[(2E)-2-[(3-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135665531 |
| Molecular Formula | C18H14Cl2N4O3S |
| Molecular Weight | 437.31 g/mol |
| Exact Mass | 436.02 |
| IUPAC Name | N-(2,3-dichlorophenyl)-2-[(2E)-2-[(3-hydroxyphenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1S/C(=N/N=Cc2cccc(O)c2)NC1=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H14Cl2N4O3S/c19-12-5-2-6-13(16(12)20)22-15(26)8-14-17(27)23-18(28-14)24-21-9-10-3-1-4-11(25)7-10/h1-7,9,14,25H,8H2,(H,22,26)(H,23,24,27) |
| InChIKey | KIOHEGCHUPFBQO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|