C20H18Cl2N4O2S — CID 135796453
2-[(2E)-2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,6-dimethylphenyl)acetamide (PubChem CID 135796453) has the molecular formula C20H18Cl2N4O2S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2-[(2E)-2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,6-dimethylphenyl)acetamide.
| Compound Name | 2-[(2E)-2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,6-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 135796453 |
| Molecular Formula | C20H18Cl2N4O2S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 2-[(2E)-2-[(2,4-dichlorophenyl)methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]-N-(2,6-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(C)c1NC(=O)CC1S/C(=N/N=Cc2ccc(Cl)cc2Cl)NC1=O |
| InChI | InChI=1S/C20H18Cl2N4O2S/c1-11-4-3-5-12(2)18(11)24-17(27)9-16-19(28)25-20(29-16)26-23-10-13-6-7-14(21)8-15(13)22/h3-8,10,16H,9H2,1-2H3,(H,24,27)(H,25,26,28) |
| InChIKey | NNWOKOJFONKJTG-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|