C19H15ClF3N3O2S — CID 135460872
N-benzyl-2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135460872) has the molecular formula C19H15ClF3N3O2S and a molecular weight of 441.86 g/mol. Its IUPAC name is N-benzyl-2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-benzyl-2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135460872 |
| Molecular Formula | C19H15ClF3N3O2S |
| Molecular Weight | 441.86 g/mol |
| Exact Mass | 441.05 |
| IUPAC Name | N-benzyl-2-[2-[4-chloro-3-(trifluoromethyl)phenyl]imino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | O=C(CC1S/C(=N\c2ccc(Cl)c(C(F)(F)F)c2)NC1=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H15ClF3N3O2S/c20-14-7-6-12(8-13(14)19(21,22)23)25-18-26-17(28)15(29-18)9-16(27)24-10-11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,24,27)(H,25,26,28) |
| InChIKey | PWSRUNPHMRUUKH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|