C14H16ClN3O3S — CID 135836348
N-(3-chloro-4-methoxyphenyl)-2-[(5R)-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide (PubChem CID 135836348) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-2-[(5R)-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-2-[(5R)-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
|---|---|
| PubChem CID | 135836348 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-2-[(5R)-2-ethylimino-4-oxo-1,3-thiazolidin-5-yl]acetamide |
| SMILES | CC/N=C1\NC(=O)[C@@H](CC(=O)Nc2ccc(OC)c(Cl)c2)S1 |
| InChI | InChI=1S/C14H16ClN3O3S/c1-3-16-14-18-13(20)11(22-14)7-12(19)17-8-4-5-10(21-2)9(15)6-8/h4-6,11H,3,7H2,1-2H3,(H,17,19)(H,16,18,20)/t11-/m1/s1 |
| InChIKey | NHFSKDUEUKXYHY-LLVKDONJSA-N |
| XLogP | 2.28 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|