C22H21FN4O — CID 118382434
1-[4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidin-1-yl]ethanone (PubChem CID 118382434) has the molecular formula C22H21FN4O and a molecular weight of 376.44 g/mol. Its IUPAC name is 1-[4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118382434 |
| Molecular Formula | C22H21FN4O |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-[4-[6-(6-fluoro-1H-indol-3-yl)indazol-1-yl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(n2ncc3ccc(-c4c[nH]c5cc(F)ccc45)cc32)CC1 |
| InChI | InChI=1S/C22H21FN4O/c1-14(28)26-8-6-18(7-9-26)27-22-10-15(2-3-16(22)12-25-27)20-13-24-21-11-17(23)4-5-19(20)21/h2-5,10-13,18,24H,6-9H2,1H3 |
| InChIKey | JGOJWQIZUPYXLD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |