C12H22N2O4 — CID 118383258
[(4-ethoxycarbonyl-4-ethylcyclohexyl)amino]carbamic acid (PubChem CID 118383258) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is [(4-ethoxycarbonyl-4-ethylcyclohexyl)amino]carbamic acid.
| Compound Name | [(4-ethoxycarbonyl-4-ethylcyclohexyl)amino]carbamic acid |
|---|---|
| PubChem CID | 118383258 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | [(4-ethoxycarbonyl-4-ethylcyclohexyl)amino]carbamic acid |
| SMILES | CCOC(=O)C1(CC)CCC(NNC(=O)O)CC1 |
| InChI | InChI=1S/C12H22N2O4/c1-3-12(10(15)18-4-2)7-5-9(6-8-12)13-14-11(16)17/h9,13-14H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | QUYXZQINGSXERL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|