C18H14N4OS — CID 11838460
4-amino-11,13-dimethyl-6-pyridin-3-yl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-5-carbonitrile (PubChem CID 11838460) has the molecular formula C18H14N4OS and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-amino-11,13-dimethyl-6-pyridin-3-yl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-5-carbonitrile.
| Compound Name | 4-amino-11,13-dimethyl-6-pyridin-3-yl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 11838460 |
| Molecular Formula | C18H14N4OS |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4-amino-11,13-dimethyl-6-pyridin-3-yl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaene-5-carbonitrile |
| SMILES | Cc1cc(C)c2c3c(sc2n1)C(c1cccnc1)C(C#N)=C(N)O3 |
| InChI | InChI=1S/C18H14N4OS/c1-9-6-10(2)22-18-13(9)15-16(24-18)14(11-4-3-5-21-8-11)12(7-19)17(20)23-15/h3-6,8,14H,20H2,1-2H3 |
| InChIKey | VQHPRRDVDAAKQA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|