C21H17N3O3S — CID 5211564
methyl 4-(4-amino-5-cyano-11,13-dimethyl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaen-6-yl)benzoate (PubChem CID 5211564) has the molecular formula C21H17N3O3S and a molecular weight of 391.45 g/mol. Its IUPAC name is methyl 4-(4-amino-5-cyano-11,13-dimethyl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaen-6-yl)benzoate.
| Compound Name | methyl 4-(4-amino-5-cyano-11,13-dimethyl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaen-6-yl)benzoate |
|---|---|
| PubChem CID | 5211564 |
| Molecular Formula | C21H17N3O3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | methyl 4-(4-amino-5-cyano-11,13-dimethyl-3-oxa-8-thia-10-azatricyclo[7.4.0.02,7]trideca-1(9),2(7),4,10,12-pentaen-6-yl)benzoate |
| SMILES | COC(=O)c1ccc(C2C(C#N)=C(N)Oc3c2sc2nc(C)cc(C)c32)cc1 |
| InChI | InChI=1S/C21H17N3O3S/c1-10-8-11(2)24-20-15(10)17-18(28-20)16(14(9-22)19(23)27-17)12-4-6-13(7-5-12)21(25)26-3/h4-8,16H,23H2,1-3H3 |
| InChIKey | MORNQLJJWANHSE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|