C18H16N2O5S — CID 7596270
methyl (7S)-5-amino-6-cyano-7-(4-hydroxy-3-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate (PubChem CID 7596270) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is methyl (7S)-5-amino-6-cyano-7-(4-hydroxy-3-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate.
| Compound Name | methyl (7S)-5-amino-6-cyano-7-(4-hydroxy-3-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 7596270 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | methyl (7S)-5-amino-6-cyano-7-(4-hydroxy-3-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate |
| SMILES | COC(=O)c1c(C)sc2c1OC(N)=C(C#N)[C@@H]2c1ccc(O)c(OC)c1 |
| InChI | InChI=1S/C18H16N2O5S/c1-8-13(18(22)24-3)15-16(26-8)14(10(7-19)17(20)25-15)9-4-5-11(21)12(6-9)23-2/h4-6,14,21H,20H2,1-3H3/t14-/m0/s1 |
| InChIKey | HGTVGJWXHDLNFG-AWEZNQCLSA-N |
| XLogP | 2.78 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|