C17H12Cl2N2O3S — CID 4920300
methyl 5-amino-6-cyano-7-(2,3-dichlorophenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate (PubChem CID 4920300) has the molecular formula C17H12Cl2N2O3S and a molecular weight of 395.27 g/mol. Its IUPAC name is methyl 5-amino-6-cyano-7-(2,3-dichlorophenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate.
| Compound Name | methyl 5-amino-6-cyano-7-(2,3-dichlorophenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 4920300 |
| Molecular Formula | C17H12Cl2N2O3S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | methyl 5-amino-6-cyano-7-(2,3-dichlorophenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate |
| SMILES | COC(=O)c1c(C)sc2c1OC(N)=C(C#N)C2c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H12Cl2N2O3S/c1-7-11(17(22)23-2)14-15(25-7)12(9(6-20)16(21)24-14)8-4-3-5-10(18)13(8)19/h3-5,12H,21H2,1-2H3 |
| InChIKey | RBNHTQIYCQLBAP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|