C18H16N2O4S — CID 4908149
methyl 5-amino-6-cyano-7-(4-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate (PubChem CID 4908149) has the molecular formula C18H16N2O4S and a molecular weight of 356.40 g/mol. Its IUPAC name is methyl 5-amino-6-cyano-7-(4-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate.
| Compound Name | methyl 5-amino-6-cyano-7-(4-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate |
|---|---|
| PubChem CID | 4908149 |
| Molecular Formula | C18H16N2O4S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | methyl 5-amino-6-cyano-7-(4-methoxyphenyl)-2-methyl-7H-thieno[3,2-b]pyran-3-carboxylate |
| SMILES | COC(=O)c1c(C)sc2c1OC(N)=C(C#N)C2c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H16N2O4S/c1-9-13(18(21)23-3)15-16(25-9)14(12(8-19)17(20)24-15)10-4-6-11(22-2)7-5-10/h4-7,14H,20H2,1-3H3 |
| InChIKey | ZFLDZYUZDFPGSS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|