C18H18N2O4 — CID 4264900
prop-2-enyl 6-amino-5-cyano-4-(4-methoxyphenyl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 4264900) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is prop-2-enyl 6-amino-5-cyano-4-(4-methoxyphenyl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | prop-2-enyl 6-amino-5-cyano-4-(4-methoxyphenyl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 4264900 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | prop-2-enyl 6-amino-5-cyano-4-(4-methoxyphenyl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18N2O4/c1-4-9-23-18(21)15-11(2)24-17(20)14(10-19)16(15)12-5-7-13(22-3)8-6-12/h4-8,16H,1,9,20H2,2-3H3 |
| InChIKey | BHZDMRYJUXIQQI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|