C17H14Cl2N2O3 — CID 3485504
prop-2-enyl 6-amino-5-cyano-4-(2,4-dichlorophenyl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 3485504) has the molecular formula C17H14Cl2N2O3 and a molecular weight of 365.22 g/mol. Its IUPAC name is prop-2-enyl 6-amino-5-cyano-4-(2,4-dichlorophenyl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | prop-2-enyl 6-amino-5-cyano-4-(2,4-dichlorophenyl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 3485504 |
| Molecular Formula | C17H14Cl2N2O3 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | prop-2-enyl 6-amino-5-cyano-4-(2,4-dichlorophenyl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)OC(N)=C(C#N)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O3/c1-3-6-23-17(22)14-9(2)24-16(21)12(8-20)15(14)11-5-4-10(18)7-13(11)19/h3-5,7,15H,1,6,21H2,2H3 |
| InChIKey | VNOXXCFFCOKSIU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|