C22H21N3O4 — CID 7107930
prop-2-enyl (4S)-6-amino-5-cyano-4-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 7107930) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is prop-2-enyl (4S)-6-amino-5-cyano-4-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | prop-2-enyl (4S)-6-amino-5-cyano-4-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 7107930 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | prop-2-enyl (4S)-6-amino-5-cyano-4-(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)OC(N)=C(C#N)[C@H]1c1cc2cc(C)cc(C)c2[nH]c1=O |
| InChI | InChI=1S/C22H21N3O4/c1-5-6-28-22(27)17-13(4)29-20(24)16(10-23)18(17)15-9-14-8-11(2)7-12(3)19(14)25-21(15)26/h5,7-9,18H,1,6,24H2,2-4H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | AORKXGUQOWHDQU-GOSISDBHSA-N |
| XLogP | 2.96 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|