C21H19N3O4 — CID 7107919
prop-2-enyl (4S)-6-amino-5-cyano-2-methyl-4-(8-methyl-2-oxo-1H-quinolin-3-yl)-4H-pyran-3-carboxylate (PubChem CID 7107919) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is prop-2-enyl (4S)-6-amino-5-cyano-2-methyl-4-(8-methyl-2-oxo-1H-quinolin-3-yl)-4H-pyran-3-carboxylate.
| Compound Name | prop-2-enyl (4S)-6-amino-5-cyano-2-methyl-4-(8-methyl-2-oxo-1H-quinolin-3-yl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 7107919 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | prop-2-enyl (4S)-6-amino-5-cyano-2-methyl-4-(8-methyl-2-oxo-1H-quinolin-3-yl)-4H-pyran-3-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)OC(N)=C(C#N)[C@H]1c1cc2cccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C21H19N3O4/c1-4-8-27-21(26)16-12(3)28-19(23)15(10-22)17(16)14-9-13-7-5-6-11(2)18(13)24-20(14)25/h4-7,9,17H,1,8,23H2,2-3H3,(H,24,25)/t17-/m1/s1 |
| InChIKey | AMOMAENWNVYZHX-QGZVFWFLSA-N |
| XLogP | 2.65 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|