C19H16ClN3O3 — CID 1374274
methyl (4S)-6-amino-4-(2-chloro-8-methylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 1374274) has the molecular formula C19H16ClN3O3 and a molecular weight of 369.81 g/mol. Its IUPAC name is methyl (4S)-6-amino-4-(2-chloro-8-methylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | methyl (4S)-6-amino-4-(2-chloro-8-methylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 1374274 |
| Molecular Formula | C19H16ClN3O3 |
| Molecular Weight | 369.81 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | methyl (4S)-6-amino-4-(2-chloro-8-methylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | COC(=O)C1=C(C)OC(N)=C(C#N)[C@@H]1c1cc2cccc(C)c2nc1Cl |
| InChI | InChI=1S/C19H16ClN3O3/c1-9-5-4-6-11-7-12(17(20)23-16(9)11)15-13(8-21)18(22)26-10(2)14(15)19(24)25-3/h4-7,15H,22H2,1-3H3/t15-/m0/s1 |
| InChIKey | OSOQKFJHSSUMST-HNNXBMFYSA-N |
| XLogP | 3.45 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.81 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|