C23H24ClN3O3 — CID 3167155
tert-butyl 6-amino-4-(2-chloro-7,8-dimethylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate (PubChem CID 3167155) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is tert-butyl 6-amino-4-(2-chloro-7,8-dimethylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | tert-butyl 6-amino-4-(2-chloro-7,8-dimethylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 3167155 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | tert-butyl 6-amino-4-(2-chloro-7,8-dimethylquinolin-3-yl)-5-cyano-2-methyl-4H-pyran-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)C(c2cc3ccc(C)c(C)c3nc2Cl)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C23H24ClN3O3/c1-11-7-8-14-9-15(20(24)27-19(14)12(11)2)18-16(10-25)21(26)29-13(3)17(18)22(28)30-23(4,5)6/h7-9,18H,26H2,1-6H3 |
| InChIKey | BQQOUOYJTIRPDN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|