C17H18N2O5 — CID 829231
methyl (4R)-6-amino-5-cyano-2-ethyl-4-(4-hydroxy-3-methoxyphenyl)-4H-pyran-3-carboxylate (PubChem CID 829231) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is methyl (4R)-6-amino-5-cyano-2-ethyl-4-(4-hydroxy-3-methoxyphenyl)-4H-pyran-3-carboxylate.
| Compound Name | methyl (4R)-6-amino-5-cyano-2-ethyl-4-(4-hydroxy-3-methoxyphenyl)-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 829231 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | methyl (4R)-6-amino-5-cyano-2-ethyl-4-(4-hydroxy-3-methoxyphenyl)-4H-pyran-3-carboxylate |
| SMILES | CCC1=C(C(=O)OC)[C@H](c2ccc(O)c(OC)c2)C(C#N)=C(N)O1 |
| InChI | InChI=1S/C17H18N2O5/c1-4-12-15(17(21)23-3)14(10(8-18)16(19)24-12)9-5-6-11(20)13(7-9)22-2/h5-7,14,20H,4,19H2,1-3H3/t14-/m1/s1 |
| InChIKey | ZXWGAESYTOVIRD-CQSZACIVSA-N |
| XLogP | 2.05 |
| TPSA | 114.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |