C28H20N4O2S2 — CID 25098790
4-amino-6-(4-methoxyphenyl)-11-methylsulfanyl-13-naphthalen-2-yl-3-oxa-8-thia-10,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile (PubChem CID 25098790) has the molecular formula C28H20N4O2S2 and a molecular weight of 508.63 g/mol. Its IUPAC name is 4-amino-6-(4-methoxyphenyl)-11-methylsulfanyl-13-naphthalen-2-yl-3-oxa-8-thia-10,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile.
| Compound Name | 4-amino-6-(4-methoxyphenyl)-11-methylsulfanyl-13-naphthalen-2-yl-3-oxa-8-thia-10,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 25098790 |
| Molecular Formula | C28H20N4O2S2 |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 4-amino-6-(4-methoxyphenyl)-11-methylsulfanyl-13-naphthalen-2-yl-3-oxa-8-thia-10,12-diazatricyclo[7.4.0.02,7]trideca-1(13),2(7),4,9,11-pentaene-5-carbonitrile |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3c2sc2nc(SC)nc(-c4ccc5ccccc5c4)c32)cc1 |
| InChI | InChI=1S/C28H20N4O2S2/c1-33-19-11-9-16(10-12-19)21-20(14-29)26(30)34-24-22-23(31-28(35-2)32-27(22)36-25(21)24)18-8-7-15-5-3-4-6-17(15)13-18/h3-13,21H,30H2,1-2H3 |
| InChIKey | QYNCSRHSOKIVHE-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_D(5)', 'substructure': 'N/A'} |
|---|