C20H22N2O5 — CID 3154859
tert-butyl 6-amino-5-cyano-4-(4-methoxycarbonylphenyl)-2-methyl-4H-pyran-3-carboxylate (PubChem CID 3154859) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is tert-butyl 6-amino-5-cyano-4-(4-methoxycarbonylphenyl)-2-methyl-4H-pyran-3-carboxylate.
| Compound Name | tert-butyl 6-amino-5-cyano-4-(4-methoxycarbonylphenyl)-2-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 3154859 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | tert-butyl 6-amino-5-cyano-4-(4-methoxycarbonylphenyl)-2-methyl-4H-pyran-3-carboxylate |
| SMILES | COC(=O)c1ccc(C2C(C#N)=C(N)OC(C)=C2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H22N2O5/c1-11-15(19(24)27-20(2,3)4)16(14(10-21)17(22)26-11)12-6-8-13(9-7-12)18(23)25-5/h6-9,16H,22H2,1-5H3 |
| InChIKey | XGTMGMYOCDBSGA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 111.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |