C23H24FN3O4 — CID 118385821
(2S)-2-[2-fluoro-8-(phenylmethoxycarbonylamino)-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]butanoic acid (PubChem CID 118385821) has the molecular formula C23H24FN3O4 and a molecular weight of 425.46 g/mol. Its IUPAC name is (2S)-2-[2-fluoro-8-(phenylmethoxycarbonylamino)-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]butanoic acid.
| Compound Name | (2S)-2-[2-fluoro-8-(phenylmethoxycarbonylamino)-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]butanoic acid |
|---|---|
| PubChem CID | 118385821 |
| Molecular Formula | C23H24FN3O4 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | (2S)-2-[2-fluoro-8-(phenylmethoxycarbonylamino)-6,7,8,9-tetrahydropyrido[3,2-b]indol-5-yl]butanoic acid |
| SMILES | CC[C@@H](C(=O)O)n1c2c(c3nc(F)ccc31)CC(NC(=O)OCc1ccccc1)CC2 |
| InChI | InChI=1S/C23H24FN3O4/c1-2-17(22(28)29)27-18-9-8-15(12-16(18)21-19(27)10-11-20(24)26-21)25-23(30)31-13-14-6-4-3-5-7-14/h3-7,10-11,15,17H,2,8-9,12-13H2,1H3,(H,25,30)(H,28,29)/t15?,17-/m0/s1 |
| InChIKey | ISKNJVZPEIHZDQ-LWKPJOBUSA-N |
| XLogP | 3.99 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|