C23H19F2NO3 — CID 118387597
benzyl 5-fluoro-1-(5-fluoro-2-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 118387597) has the molecular formula C23H19F2NO3 and a molecular weight of 395.41 g/mol. Its IUPAC name is benzyl 5-fluoro-1-(5-fluoro-2-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 5-fluoro-1-(5-fluoro-2-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 118387597 |
| Molecular Formula | C23H19F2NO3 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | benzyl 5-fluoro-1-(5-fluoro-2-hydroxyphenyl)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCc2c(F)cccc2C1c1cc(F)ccc1O |
| InChI | InChI=1S/C23H19F2NO3/c24-16-9-10-21(27)19(13-16)22-18-7-4-8-20(25)17(18)11-12-26(22)23(28)29-14-15-5-2-1-3-6-15/h1-10,13,22,27H,11-12,14H2 |
| InChIKey | KCGASECNDNFKIV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|