C24H19FN2O3 — CID 118387329
benzyl 1-(5-cyano-2-hydroxyphenyl)-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 118387329) has the molecular formula C24H19FN2O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is benzyl 1-(5-cyano-2-hydroxyphenyl)-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | benzyl 1-(5-cyano-2-hydroxyphenyl)-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 118387329 |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | benzyl 1-(5-cyano-2-hydroxyphenyl)-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | N#Cc1ccc(O)c(C2c3cccc(F)c3CCN2C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C24H19FN2O3/c25-21-8-4-7-19-18(21)11-12-27(24(29)30-15-16-5-2-1-3-6-16)23(19)20-13-17(14-26)9-10-22(20)28/h1-10,13,23,28H,11-12,15H2 |
| InChIKey | UWLDYJUUMFRILP-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|