C12H17N4+ — CID 118390204
1,3-dimethyl-4-[2-(1-methyltriazol-4-yl)ethyl]pyridin-1-ium (PubChem CID 118390204) has the molecular formula C12H17N4+ and a molecular weight of 217.30 g/mol. Its IUPAC name is 1,3-dimethyl-4-[2-(1-methyltriazol-4-yl)ethyl]pyridin-1-ium.
| Compound Name | 1,3-dimethyl-4-[2-(1-methyltriazol-4-yl)ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 118390204 |
| Molecular Formula | C12H17N4+ |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | 1,3-dimethyl-4-[2-(1-methyltriazol-4-yl)ethyl]pyridin-1-ium |
| SMILES | Cc1c[n+](C)ccc1CCc1cn(C)nn1 |
| InChI | InChI=1S/C12H17N4/c1-10-8-15(2)7-6-11(10)4-5-12-9-16(3)14-13-12/h6-9H,4-5H2,1-3H3/q+1 |
| InChIKey | GPMNMWHZQMEPFM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|