C27H14N2O2 — CID 118390431
2-(2,20-dioxo-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaen-6-yl)benzonitrile (PubChem CID 118390431) has the molecular formula C27H14N2O2 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-(2,20-dioxo-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaen-6-yl)benzonitrile.
| Compound Name | 2-(2,20-dioxo-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaen-6-yl)benzonitrile |
|---|---|
| PubChem CID | 118390431 |
| Molecular Formula | C27H14N2O2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 2-(2,20-dioxo-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaen-6-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc2c(=O)n3c(=O)c4ccccc4c4cccc(c2c1)c43 |
| InChI | InChI=1S/C27H14N2O2/c28-15-17-6-1-2-7-18(17)16-12-13-23-24(14-16)21-11-5-10-20-19-8-3-4-9-22(19)26(30)29(25(20)21)27(23)31/h1-14H |
| InChIKey | CSKAAEZACJSLAN-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|