C26H14BrNO2 — CID 118390441
4-(4-bromophenyl)-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaene-2,20-dione (PubChem CID 118390441) has the molecular formula C26H14BrNO2 and a molecular weight of 452.31 g/mol. Its IUPAC name is 4-(4-bromophenyl)-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaene-2,20-dione.
| Compound Name | 4-(4-bromophenyl)-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaene-2,20-dione |
|---|---|
| PubChem CID | 118390441 |
| Molecular Formula | C26H14BrNO2 |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | 4-(4-bromophenyl)-1-azapentacyclo[11.7.1.03,8.09,21.014,19]henicosa-3(8),4,6,9,11,13(21),14,16,18-nonaene-2,20-dione |
| SMILES | O=c1c2ccccc2c2cccc3c4cccc(-c5ccc(Br)cc5)c4c(=O)n1c23 |
| InChI | InChI=1S/C26H14BrNO2/c27-16-13-11-15(12-14-16)17-7-3-8-19-21-10-4-9-20-18-5-1-2-6-22(18)25(29)28(24(20)21)26(30)23(17)19/h1-14H |
| InChIKey | VNDRXPCRNDXZBV-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 38.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|