C15H16F2S — CID 118390698
2-ethyl-3,4-difluoro-5-(4-propylphenyl)thiophene (PubChem CID 118390698) has the molecular formula C15H16F2S and a molecular weight of 266.36 g/mol. Its IUPAC name is 2-ethyl-3,4-difluoro-5-(4-propylphenyl)thiophene.
| Compound Name | 2-ethyl-3,4-difluoro-5-(4-propylphenyl)thiophene |
|---|---|
| PubChem CID | 118390698 |
| Molecular Formula | C15H16F2S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-ethyl-3,4-difluoro-5-(4-propylphenyl)thiophene |
| SMILES | CCCc1ccc(-c2sc(CC)c(F)c2F)cc1 |
| InChI | InChI=1S/C15H16F2S/c1-3-5-10-6-8-11(9-7-10)15-14(17)13(16)12(4-2)18-15/h6-9H,3-5H2,1-2H3 |
| InChIKey | UUNJFMSGKIGCTQ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |