C18H14FN3O3 — CID 118391542
methyl 3-[4-[(4-fluorophenyl)methyl-methylamino]-2,1,3-benzoxadiazol-6-yl]prop-2-ynoate (PubChem CID 118391542) has the molecular formula C18H14FN3O3 and a molecular weight of 339.33 g/mol. Its IUPAC name is methyl 3-[4-[(4-fluorophenyl)methyl-methylamino]-2,1,3-benzoxadiazol-6-yl]prop-2-ynoate.
| Compound Name | methyl 3-[4-[(4-fluorophenyl)methyl-methylamino]-2,1,3-benzoxadiazol-6-yl]prop-2-ynoate |
|---|---|
| PubChem CID | 118391542 |
| Molecular Formula | C18H14FN3O3 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | methyl 3-[4-[(4-fluorophenyl)methyl-methylamino]-2,1,3-benzoxadiazol-6-yl]prop-2-ynoate |
| SMILES | COC(=O)C#Cc1cc(N(C)Cc2ccc(F)cc2)c2nonc2c1 |
| InChI | InChI=1S/C18H14FN3O3/c1-22(11-12-3-6-14(19)7-4-12)16-10-13(5-8-17(23)24-2)9-15-18(16)21-25-20-15/h3-4,6-7,9-10H,11H2,1-2H3 |
| InChIKey | PBGNTEKAPNOTMK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|