C28H22ClFN4O3 — CID 118391949
6-chloro-5-[3-[(1-cyanocyclopentyl)carbamoyl]phenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide (PubChem CID 118391949) has the molecular formula C28H22ClFN4O3 and a molecular weight of 516.96 g/mol. Its IUPAC name is 6-chloro-5-[3-[(1-cyanocyclopentyl)carbamoyl]phenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-chloro-5-[3-[(1-cyanocyclopentyl)carbamoyl]phenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118391949 |
| Molecular Formula | C28H22ClFN4O3 |
| Molecular Weight | 516.96 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | 6-chloro-5-[3-[(1-cyanocyclopentyl)carbamoyl]phenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(Cl)c(-c3cccc(C(=O)NC4(C#N)CCCC4)c3)cc12 |
| InChI | InChI=1S/C28H22ClFN4O3/c1-32-26(36)22-21-14-20(24(29)33-27(21)37-23(22)16-7-9-19(30)10-8-16)17-5-4-6-18(13-17)25(35)34-28(15-31)11-2-3-12-28/h4-10,13-14H,2-3,11-12H2,1H3,(H,32,36)(H,34,35) |
| InChIKey | SLRVJAMGVFJQBW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.96 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|