C22H13ClF2N2O4 — CID 118390591
3-[6-chloro-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridin-5-yl]-4-fluorobenzoic acid (PubChem CID 118390591) has the molecular formula C22H13ClF2N2O4 and a molecular weight of 442.81 g/mol. Its IUPAC name is 3-[6-chloro-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridin-5-yl]-4-fluorobenzoic acid.
| Compound Name | 3-[6-chloro-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridin-5-yl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 118390591 |
| Molecular Formula | C22H13ClF2N2O4 |
| Molecular Weight | 442.81 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 3-[6-chloro-2-(4-fluorophenyl)-3-(methylcarbamoyl)furo[2,3-b]pyridin-5-yl]-4-fluorobenzoic acid |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(Cl)c(-c3cc(C(=O)O)ccc3F)cc12 |
| InChI | InChI=1S/C22H13ClF2N2O4/c1-26-20(28)17-15-9-14(13-8-11(22(29)30)4-7-16(13)25)19(23)27-21(15)31-18(17)10-2-5-12(24)6-3-10/h2-9H,1H3,(H,26,28)(H,29,30) |
| InChIKey | RNKAWFWUILNOGG-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.81 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|