C20H11ClFN3O4 — CID 123752022
5-[3-carbamoyl-6-chloro-2-(4-fluorophenyl)furo[2,3-b]pyridin-5-yl]pyridine-3-carboxylic acid (PubChem CID 123752022) has the molecular formula C20H11ClFN3O4 and a molecular weight of 411.78 g/mol. Its IUPAC name is 5-[3-carbamoyl-6-chloro-2-(4-fluorophenyl)furo[2,3-b]pyridin-5-yl]pyridine-3-carboxylic acid.
| Compound Name | 5-[3-carbamoyl-6-chloro-2-(4-fluorophenyl)furo[2,3-b]pyridin-5-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 123752022 |
| Molecular Formula | C20H11ClFN3O4 |
| Molecular Weight | 411.78 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 5-[3-carbamoyl-6-chloro-2-(4-fluorophenyl)furo[2,3-b]pyridin-5-yl]pyridine-3-carboxylic acid |
| SMILES | NC(=O)c1c(-c2ccc(F)cc2)oc2nc(Cl)c(-c3cncc(C(=O)O)c3)cc12 |
| InChI | InChI=1S/C20H11ClFN3O4/c21-17-13(10-5-11(20(27)28)8-24-7-10)6-14-15(18(23)26)16(29-19(14)25-17)9-1-3-12(22)4-2-9/h1-8H,(H2,23,26)(H,27,28) |
| InChIKey | UDQYHGWBNJANGU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|