C29H24ClFN2O4 — CID 152795669
6-chloro-5-[3-(3,3-dimethylpent-4-ynoyl)-4-methoxyphenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide (PubChem CID 152795669) has the molecular formula C29H24ClFN2O4 and a molecular weight of 518.97 g/mol. Its IUPAC name is 6-chloro-5-[3-(3,3-dimethylpent-4-ynoyl)-4-methoxyphenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide.
| Compound Name | 6-chloro-5-[3-(3,3-dimethylpent-4-ynoyl)-4-methoxyphenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 152795669 |
| Molecular Formula | C29H24ClFN2O4 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.14 |
| IUPAC Name | 6-chloro-5-[3-(3,3-dimethylpent-4-ynoyl)-4-methoxyphenyl]-2-(4-fluorophenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide |
| SMILES | C#CC(C)(C)CC(=O)c1cc(-c2cc3c(C(=O)NC)c(-c4ccc(F)cc4)oc3nc2Cl)ccc1OC |
| InChI | InChI=1S/C29H24ClFN2O4/c1-6-29(2,3)15-22(34)20-13-17(9-12-23(20)36-5)19-14-21-24(27(35)32-4)25(37-28(21)33-26(19)30)16-7-10-18(31)11-8-16/h1,7-14H,15H2,2-5H3,(H,32,35) |
| InChIKey | SLUXIRFJJACSKN-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|