C28H22ClF8N3O4 — CID 145014859
6-chloro-2-(4-fluorophenyl)-5-(3-formyl-4-methoxyphenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide;2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-amine (PubChem CID 145014859) has the molecular formula C28H22ClF8N3O4 and a molecular weight of 651.94 g/mol. Its IUPAC name is 6-chloro-2-(4-fluorophenyl)-5-(3-formyl-4-methoxyphenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide;2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-amine.
| Compound Name | 6-chloro-2-(4-fluorophenyl)-5-(3-formyl-4-methoxyphenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide;2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 145014859 |
| Molecular Formula | C28H22ClF8N3O4 |
| Molecular Weight | 651.94 g/mol |
| Exact Mass | 651.12 |
| IUPAC Name | 6-chloro-2-(4-fluorophenyl)-5-(3-formyl-4-methoxyphenyl)-N-methylfuro[2,3-b]pyridine-3-carboxamide;2,2,3,3,4,4,4-heptafluoro-N-methylbutan-1-amine |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(Cl)c(-c3ccc(OC)c(C=O)c3)cc12.CNCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C23H16ClFN2O4.C5H6F7N/c1-26-22(29)19-17-10-16(13-5-8-18(30-2)14(9-13)11-28)21(24)27-23(17)31-20(19)12-3-6-15(25)7-4-12;1-13-2-3(6,7)4(8,9)5(10,11)12/h3-11H,1-2H3,(H,26,29);13H,2H2,1H3 |
| InChIKey | ZWEOFFWWCYWPPQ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.94 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|