C29H20F11N3O3 — CID 118896060
2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 118896060) has the molecular formula C29H20F11N3O3 and a molecular weight of 667.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118896060 |
| Molecular Formula | C29H20F11N3O3 |
| Molecular Weight | 667.48 g/mol |
| Exact Mass | 667.13 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CCC(F)(F)F)c(-c3cccc(C(=O)NCC(F)(F)C(F)(F)C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C29H20F11N3O3/c1-41-24(45)21-19-12-18(15-3-2-4-16(11-15)23(44)42-13-26(31,32)28(36,37)29(38,39)40)20(9-10-27(33,34)35)43-25(19)46-22(21)14-5-7-17(30)8-6-14/h2-8,11-12H,9-10,13H2,1H3,(H,41,45)(H,42,44) |
| InChIKey | HUOQOIUBJZPABX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.48 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|