C31H30F7N3O4 — CID 161200005
5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide;2,2,2-trifluoroethanol (PubChem CID 161200005) has the molecular formula C31H30F7N3O4 and a molecular weight of 641.58 g/mol. Its IUPAC name is 5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide;2,2,2-trifluoroethanol.
| Compound Name | 5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide;2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 161200005 |
| Molecular Formula | C31H30F7N3O4 |
| Molecular Weight | 641.58 g/mol |
| Exact Mass | 641.21 |
| IUPAC Name | 5-[3-(tert-butylcarbamoyl)phenyl]-2-(4-fluorophenyl)-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide;2,2,2-trifluoroethanol |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CCC(F)(F)F)c(-c3cccc(C(=O)NC(C)(C)C)c3)cc12.OCC(F)(F)F |
| InChI | InChI=1S/C29H27F4N3O3.C2H3F3O/c1-28(2,3)36-25(37)18-7-5-6-17(14-18)20-15-21-23(26(38)34-4)24(16-8-10-19(30)11-9-16)39-27(21)35-22(20)12-13-29(31,32)33;3-2(4,5)1-6/h5-11,14-15H,12-13H2,1-4H3,(H,34,38)(H,36,37);6H,1H2 |
| InChIKey | UUVSOWIMYJZOCG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.58 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |