C30H22F11N3O4 — CID 118896056
2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 118896056) has the molecular formula C30H22F11N3O4 and a molecular weight of 697.50 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118896056 |
| Molecular Formula | C30H22F11N3O4 |
| Molecular Weight | 697.50 g/mol |
| Exact Mass | 697.14 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CCC(F)(F)F)c(-c3ccc(OC)c(C(=O)NCC(F)(F)C(F)(F)C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C30H22F11N3O4/c1-42-25(46)22-19-12-17(20(9-10-28(34,35)36)44-26(19)48-23(22)14-3-6-16(31)7-4-14)15-5-8-21(47-2)18(11-15)24(45)43-13-27(32,33)29(37,38)30(39,40)41/h3-8,11-12H,9-10,13H2,1-2H3,(H,42,46)(H,43,45) |
| InChIKey | NUFOJGNWCLRTCD-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.50 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|