C28H21F8N3O3 — CID 118896054
2-(4-fluorophenyl)-5-[4-fluoro-3-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide (PubChem CID 118896054) has the molecular formula C28H21F8N3O3 and a molecular weight of 599.48 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[4-fluoro-3-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-[4-fluoro-3-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118896054 |
| Molecular Formula | C28H21F8N3O3 |
| Molecular Weight | 599.48 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[4-fluoro-3-(1,1,1-trifluoropropan-2-ylcarbamoyl)phenyl]-N-methyl-6-(3,3,3-trifluoropropyl)furo[2,3-b]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2nc(CCC(F)(F)F)c(-c3ccc(F)c(C(=O)NC(C)C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C28H21F8N3O3/c1-13(28(34,35)36)38-24(40)18-11-15(5-8-20(18)30)17-12-19-22(25(41)37-2)23(14-3-6-16(29)7-4-14)42-26(19)39-21(17)9-10-27(31,32)33/h3-8,11-13H,9-10H2,1-2H3,(H,37,41)(H,38,40) |
| InChIKey | IXFUTKNLTHQRFG-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.48 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |