C28H19F8N3O6 — CID 118384367
2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-nitro-1-benzofuran-3-carboxamide (PubChem CID 118384367) has the molecular formula C28H19F8N3O6 and a molecular weight of 645.46 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-nitro-1-benzofuran-3-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-nitro-1-benzofuran-3-carboxamide |
|---|---|
| PubChem CID | 118384367 |
| Molecular Formula | C28H19F8N3O6 |
| Molecular Weight | 645.46 g/mol |
| Exact Mass | 645.11 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[3-(2,2,3,3,4,4,4-heptafluorobutylcarbamoyl)-4-methoxyphenyl]-N-methyl-6-nitro-1-benzofuran-3-carboxamide |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc([N+](=O)[O-])c(-c3ccc(OC)c(C(=O)NCC(F)(F)C(F)(F)C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C28H19F8N3O6/c1-37-25(41)22-17-10-16(19(39(42)43)11-21(17)45-23(22)13-3-6-15(29)7-4-13)14-5-8-20(44-2)18(9-14)24(40)38-12-26(30,31)27(32,33)28(34,35)36/h3-11H,12H2,1-2H3,(H,37,41)(H,38,40) |
| InChIKey | NJHFGHPXJTXHRL-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.46 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|