C32H28F7N3O4 — CID 135267624
6-(4-fluorophenyl)-10-[3-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)carbamoyl]-4-methoxyphenyl]-N,4-dimethyl-1H-oxonino[4,3-b]pyrrole-7-carboxamide (PubChem CID 135267624) has the molecular formula C32H28F7N3O4 and a molecular weight of 651.58 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-10-[3-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)carbamoyl]-4-methoxyphenyl]-N,4-dimethyl-1H-oxonino[4,3-b]pyrrole-7-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-10-[3-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)carbamoyl]-4-methoxyphenyl]-N,4-dimethyl-1H-oxonino[4,3-b]pyrrole-7-carboxamide |
|---|---|
| PubChem CID | 135267624 |
| Molecular Formula | C32H28F7N3O4 |
| Molecular Weight | 651.58 g/mol |
| Exact Mass | 651.20 |
| IUPAC Name | 6-(4-fluorophenyl)-10-[3-[(2,3,3,4,4,4-hexafluoro-2-methylbutyl)carbamoyl]-4-methoxyphenyl]-N,4-dimethyl-1H-oxonino[4,3-b]pyrrole-7-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(OC)c(C(=O)NCC(C)(F)C(F)(F)C(F)(F)F)c2)c2[nH]ccc2c(C)oc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C32H28F7N3O4/c1-17-21-13-14-41-26(21)22(10-11-23(28(43)40-3)27(46-17)18-5-8-20(33)9-6-18)19-7-12-25(45-4)24(15-19)29(44)42-16-30(2,34)31(35,36)32(37,38)39/h5-15,41H,16H2,1-4H3,(H,40,43)(H,42,44)/b11-10-,21-17-,26-22-,27-23+ |
| InChIKey | DGSSRVGKCVAWMO-COTKKLSMSA-N |
| XLogP | 7.69 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.58 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|