C28H24F4N2O6S — CID 87311393
[4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-2-(2-methylpropylcarbamoyl)phenyl] trifluoromethanesulfonate (PubChem CID 87311393) has the molecular formula C28H24F4N2O6S and a molecular weight of 592.57 g/mol. Its IUPAC name is [4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-2-(2-methylpropylcarbamoyl)phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-2-(2-methylpropylcarbamoyl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87311393 |
| Molecular Formula | C28H24F4N2O6S |
| Molecular Weight | 592.57 g/mol |
| Exact Mass | 592.13 |
| IUPAC Name | [4-[2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl]-2-(2-methylpropylcarbamoyl)phenyl] trifluoromethanesulfonate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2ccc(-c3ccc(OS(=O)(=O)C(F)(F)F)c(C(=O)NCC(C)C)c3)cc12 |
| InChI | InChI=1S/C28H24F4N2O6S/c1-15(2)14-34-26(35)21-13-18(7-11-23(21)40-41(37,38)28(30,31)32)17-6-10-22-20(12-17)24(27(36)33-3)25(39-22)16-4-8-19(29)9-5-16/h4-13,15H,14H2,1-3H3,(H,33,36)(H,34,35) |
| InChIKey | KFRQMCSFJUWQBS-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.57 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|