C21H20F4N2O5S — CID 122499604
[6-(diethylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate (PubChem CID 122499604) has the molecular formula C21H20F4N2O5S and a molecular weight of 488.46 g/mol. Its IUPAC name is [6-(diethylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate.
| Compound Name | [6-(diethylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 122499604 |
| Molecular Formula | C21H20F4N2O5S |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | [6-(diethylamino)-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
| SMILES | CCN(CC)c1cc2oc(-c3ccc(F)cc3)c(C(=O)NC)c2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C21H20F4N2O5S/c1-4-27(5-2)15-11-16-14(10-17(15)32-33(29,30)21(23,24)25)18(20(28)26-3)19(31-16)12-6-8-13(22)9-7-12/h6-11H,4-5H2,1-3H3,(H,26,28) |
| InChIKey | XWLXFRABMRBMSX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|