C19H16F4N2O9S3 — CID 59275442
[6-[bis(methylsulfonyl)amino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate (PubChem CID 59275442) has the molecular formula C19H16F4N2O9S3 and a molecular weight of 588.54 g/mol. Its IUPAC name is [6-[bis(methylsulfonyl)amino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate.
| Compound Name | [6-[bis(methylsulfonyl)amino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 59275442 |
| Molecular Formula | C19H16F4N2O9S3 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 588.00 |
| IUPAC Name | [6-[bis(methylsulfonyl)amino]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-5-yl] trifluoromethanesulfonate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(N(S(C)(=O)=O)S(C)(=O)=O)c(OS(=O)(=O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C19H16F4N2O9S3/c1-24-18(26)16-12-8-15(34-37(31,32)19(21,22)23)13(25(35(2,27)28)36(3,29)30)9-14(12)33-17(16)10-4-6-11(20)7-5-10/h4-9H,1-3H3,(H,24,26) |
| InChIKey | GUJBRROEPHSHSX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 157.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|